C18H26FN — CID 126583169
N-[(2E,3Z,6Z)-2-[(E)-4-fluoropent-3-enylidene]-5-methylideneocta-3,6-dienyl]cyclobutanamine (PubChem CID 126583169) has the molecular formula C18H26FN and a molecular weight of 275.41 g/mol. Its IUPAC name is N-[(2E,3Z,6Z)-2-[(E)-4-fluoropent-3-enylidene]-5-methylideneocta-3,6-dienyl]cyclobutanamine.
| Compound Name | N-[(2E,3Z,6Z)-2-[(E)-4-fluoropent-3-enylidene]-5-methylideneocta-3,6-dienyl]cyclobutanamine |
|---|---|
| PubChem CID | 126583169 |
| Molecular Formula | C18H26FN |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | N-[(2E,3Z,6Z)-2-[(E)-4-fluoropent-3-enylidene]-5-methylideneocta-3,6-dienyl]cyclobutanamine |
| SMILES | C=C(/C=C\C)/C=C\C(=C/C/C=C(\C)F)CNC1CCC1 |
| InChI | InChI=1S/C18H26FN/c1-4-7-15(2)12-13-17(9-5-8-16(3)19)14-20-18-10-6-11-18/h4,7-9,12-13,18,20H,2,5-6,10-11,14H2,1,3H3/b7-4-,13-12-,16-8+,17-9+ |
| InChIKey | GWNQZQCSHCDVQE-BEIKQEIZSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|