C28H30N2O4 — CID 126583763
(E)-6-[2-[[2-[4-(furan-2-yl)phenyl]-5-methyl-4,5-dihydroimidazol-1-yl]methyl]phenoxy]-4-methylhex-4-enoic acid (PubChem CID 126583763) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is (E)-6-[2-[[2-[4-(furan-2-yl)phenyl]-5-methyl-4,5-dihydroimidazol-1-yl]methyl]phenoxy]-4-methylhex-4-enoic acid.
| Compound Name | (E)-6-[2-[[2-[4-(furan-2-yl)phenyl]-5-methyl-4,5-dihydroimidazol-1-yl]methyl]phenoxy]-4-methylhex-4-enoic acid |
|---|---|
| PubChem CID | 126583763 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | (E)-6-[2-[[2-[4-(furan-2-yl)phenyl]-5-methyl-4,5-dihydroimidazol-1-yl]methyl]phenoxy]-4-methylhex-4-enoic acid |
| SMILES | C/C(=C\COc1ccccc1CN1C(c2ccc(-c3ccco3)cc2)=NCC1C)CCC(=O)O |
| InChI | InChI=1S/C28H30N2O4/c1-20(9-14-27(31)32)15-17-34-26-7-4-3-6-24(26)19-30-21(2)18-29-28(30)23-12-10-22(11-13-23)25-8-5-16-33-25/h3-8,10-13,15-16,21H,9,14,17-19H2,1-2H3,(H,31,32)/b20-15+ |
| InChIKey | WEWJGIUJTAYMPM-HMMYKYKNSA-N |
| XLogP | 5.79 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|