C26H27F3N2O3 — CID 126583782
6-[2-[[5-methyl-2-[4-(3,3,3-trifluoroprop-1-ynyl)phenyl]-4,5-dihydroimidazol-1-yl]methyl]phenoxy]hexanoic acid (PubChem CID 126583782) has the molecular formula C26H27F3N2O3 and a molecular weight of 472.51 g/mol. Its IUPAC name is 6-[2-[[5-methyl-2-[4-(3,3,3-trifluoroprop-1-ynyl)phenyl]-4,5-dihydroimidazol-1-yl]methyl]phenoxy]hexanoic acid.
| Compound Name | 6-[2-[[5-methyl-2-[4-(3,3,3-trifluoroprop-1-ynyl)phenyl]-4,5-dihydroimidazol-1-yl]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 126583782 |
| Molecular Formula | C26H27F3N2O3 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 6-[2-[[5-methyl-2-[4-(3,3,3-trifluoroprop-1-ynyl)phenyl]-4,5-dihydroimidazol-1-yl]methyl]phenoxy]hexanoic acid |
| SMILES | CC1CN=C(c2ccc(C#CC(F)(F)F)cc2)N1Cc1ccccc1OCCCCCC(=O)O |
| InChI | InChI=1S/C26H27F3N2O3/c1-19-17-30-25(21-12-10-20(11-13-21)14-15-26(27,28)29)31(19)18-22-7-4-5-8-23(22)34-16-6-2-3-9-24(32)33/h4-5,7-8,10-13,19H,2-3,6,9,16-18H2,1H3,(H,32,33) |
| InChIKey | ZVBVTBMORCBZIR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|