C26H37FN6O3 — CID 126583891
tert-butyl N-[4-[[[3-(butylamino)-1,2,4-triazin-6-yl]-(4-fluorophenyl)methyl]carbamoyl]cyclohexyl]carbamate (PubChem CID 126583891) has the molecular formula C26H37FN6O3 and a molecular weight of 500.62 g/mol. Its IUPAC name is tert-butyl N-[4-[[[3-(butylamino)-1,2,4-triazin-6-yl]-(4-fluorophenyl)methyl]carbamoyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[[3-(butylamino)-1,2,4-triazin-6-yl]-(4-fluorophenyl)methyl]carbamoyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 126583891 |
| Molecular Formula | C26H37FN6O3 |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | tert-butyl N-[4-[[[3-(butylamino)-1,2,4-triazin-6-yl]-(4-fluorophenyl)methyl]carbamoyl]cyclohexyl]carbamate |
| SMILES | CCCCNc1ncc(C(NC(=O)C2CCC(NC(=O)OC(C)(C)C)CC2)c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C26H37FN6O3/c1-5-6-15-28-24-29-16-21(32-33-24)22(17-7-11-19(27)12-8-17)31-23(34)18-9-13-20(14-10-18)30-25(35)36-26(2,3)4/h7-8,11-12,16,18,20,22H,5-6,9-10,13-15H2,1-4H3,(H,30,35)(H,31,34)(H,28,29,33) |
| InChIKey | WGTKSDMHPVYZPN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 118.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|