C18H36I2 — CID 126602592
2,6-diiodo-9,14-dimethylhexadecane (PubChem CID 126602592) has the molecular formula C18H36I2 and a molecular weight of 506.29 g/mol. Its IUPAC name is 2,6-diiodo-9,14-dimethylhexadecane.
| Compound Name | 2,6-diiodo-9,14-dimethylhexadecane |
|---|---|
| PubChem CID | 126602592 |
| Molecular Formula | C18H36I2 |
| Molecular Weight | 506.29 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 2,6-diiodo-9,14-dimethylhexadecane |
| SMILES | CCC(C)CCCCC(C)CCC(I)CCCC(C)I |
| InChI | InChI=1S/C18H36I2/c1-5-15(2)9-6-7-10-16(3)13-14-18(20)12-8-11-17(4)19/h15-18H,5-14H2,1-4H3 |
| InChIKey | VVGLDQDYJJVTJJ-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.29 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|