C11H22ClN3 — CID 126609408
(2Z,4E)-3-chloro-2-N-[2-(dimethylamino)ethyl]-2-N-methylhexa-2,4-diene-2,5-diamine (PubChem CID 126609408) has the molecular formula C11H22ClN3 and a molecular weight of 231.77 g/mol. Its IUPAC name is (2Z,4E)-3-chloro-2-N-[2-(dimethylamino)ethyl]-2-N-methylhexa-2,4-diene-2,5-diamine.
| Compound Name | (2Z,4E)-3-chloro-2-N-[2-(dimethylamino)ethyl]-2-N-methylhexa-2,4-diene-2,5-diamine |
|---|---|
| PubChem CID | 126609408 |
| Molecular Formula | C11H22ClN3 |
| Molecular Weight | 231.77 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | (2Z,4E)-3-chloro-2-N-[2-(dimethylamino)ethyl]-2-N-methylhexa-2,4-diene-2,5-diamine |
| SMILES | C/C(=C(Cl)\C=C(/C)N)N(C)CCN(C)C |
| InChI | InChI=1S/C11H22ClN3/c1-9(13)8-11(12)10(2)15(5)7-6-14(3)4/h8H,6-7,13H2,1-5H3/b9-8+,11-10- |
| InChIKey | FBJKTYULZLWFCH-OCBXPSTGSA-N |
| XLogP | 1.81 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.77 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|