C11H19ClN2 — CID 142128705
N'-[(3E)-3-chlorohexa-1,3,5-trien-2-yl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 142128705) has the molecular formula C11H19ClN2 and a molecular weight of 214.74 g/mol. Its IUPAC name is N'-[(3E)-3-chlorohexa-1,3,5-trien-2-yl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[(3E)-3-chlorohexa-1,3,5-trien-2-yl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 142128705 |
| Molecular Formula | C11H19ClN2 |
| Molecular Weight | 214.74 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | N'-[(3E)-3-chlorohexa-1,3,5-trien-2-yl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | C=C/C=C(/Cl)C(=C)N(C)CCN(C)C |
| InChI | InChI=1S/C11H19ClN2/c1-6-7-11(12)10(2)14(5)9-8-13(3)4/h6-7H,1-2,8-9H2,3-5H3/b11-7+ |
| InChIKey | PXLFYHBPKQKZLT-YRNVUSSQSA-N |
| XLogP | 2.30 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.74 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|