C12H11F7 — CID 126626968
8-fluoro-8-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)tricyclo[4.2.0.01,3]oct-4-ene (PubChem CID 126626968) has the molecular formula C12H11F7 and a molecular weight of 288.21 g/mol. Its IUPAC name is 8-fluoro-8-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)tricyclo[4.2.0.01,3]oct-4-ene.
| Compound Name | 8-fluoro-8-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)tricyclo[4.2.0.01,3]oct-4-ene |
|---|---|
| PubChem CID | 126626968 |
| Molecular Formula | C12H11F7 |
| Molecular Weight | 288.21 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 8-fluoro-8-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)tricyclo[4.2.0.01,3]oct-4-ene |
| SMILES | CC(C(F)(F)F)(C(F)(F)F)C1(F)CC2C=CC3CC321 |
| InChI | InChI=1S/C12H11F7/c1-8(11(14,15)16,12(17,18)19)10(13)5-7-3-2-6-4-9(6,7)10/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | PKZAXGZKOFNRKH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.21 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|