C11H17F3OSi — CID 85107343
trimethyl-[[7-(trifluoromethyl)-7-bicyclo[2.2.1]hept-2-enyl]oxy]silane (PubChem CID 85107343) has the molecular formula C11H17F3OSi and a molecular weight of 250.34 g/mol. Its IUPAC name is trimethyl-[[7-(trifluoromethyl)-7-bicyclo[2.2.1]hept-2-enyl]oxy]silane.
| Compound Name | trimethyl-[[7-(trifluoromethyl)-7-bicyclo[2.2.1]hept-2-enyl]oxy]silane |
|---|---|
| PubChem CID | 85107343 |
| Molecular Formula | C11H17F3OSi |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | trimethyl-[[7-(trifluoromethyl)-7-bicyclo[2.2.1]hept-2-enyl]oxy]silane |
| SMILES | C[Si](C)(C)OC1(C(F)(F)F)C2C=CC1CC2 |
| InChI | InChI=1S/C11H17F3OSi/c1-16(2,3)15-10(11(12,13)14)8-4-5-9(10)7-6-8/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | XHDONAOPCIFNGY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|