C9H11F3O3S — CID 10083720
[(1R,4S)-7-(trifluoromethyl)-7-bicyclo[2.2.1]hept-2-enyl] methanesulfonate (PubChem CID 10083720) has the molecular formula C9H11F3O3S and a molecular weight of 256.24 g/mol. Its IUPAC name is [(1R,4S)-7-(trifluoromethyl)-7-bicyclo[2.2.1]hept-2-enyl] methanesulfonate.
| Compound Name | [(1R,4S)-7-(trifluoromethyl)-7-bicyclo[2.2.1]hept-2-enyl] methanesulfonate |
|---|---|
| PubChem CID | 10083720 |
| Molecular Formula | C9H11F3O3S |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | [(1R,4S)-7-(trifluoromethyl)-7-bicyclo[2.2.1]hept-2-enyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1(C(F)(F)F)[C@@H]2C=C[C@H]1CC2 |
| InChI | InChI=1S/C9H11F3O3S/c1-16(13,14)15-8(9(10,11)12)6-2-3-7(8)5-4-6/h2-3,6-7H,4-5H2,1H3/t6-,7+,8? |
| InChIKey | CJIVRZCNXHESPE-DHBOJHSNSA-N |
| XLogP | 1.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|