C5H3F7S — CID 87128815
2,2,3,5-tetrafluoro-3-(trifluoromethyl)thiolane (PubChem CID 87128815) has the molecular formula C5H3F7S and a molecular weight of 228.13 g/mol. Its IUPAC name is 2,2,3,5-tetrafluoro-3-(trifluoromethyl)thiolane.
| Compound Name | 2,2,3,5-tetrafluoro-3-(trifluoromethyl)thiolane |
|---|---|
| PubChem CID | 87128815 |
| Molecular Formula | C5H3F7S |
| Molecular Weight | 228.13 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | 2,2,3,5-tetrafluoro-3-(trifluoromethyl)thiolane |
| SMILES | FC1CC(F)(C(F)(F)F)C(F)(F)S1 |
| InChI | InChI=1S/C5H3F7S/c6-2-1-3(7,4(8,9)10)5(11,12)13-2/h2H,1H2 |
| InChIKey | RXAVYPRZKPHMGS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.13 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |