C30H28N2O2 — CID 126635867
5-[(1E,6E)-7-[2-methoxy-4-(pyridin-3-ylmethoxy)phenyl]-3,5-dimethylidenehepta-1,6-dienyl]-1H-indole (PubChem CID 126635867) has the molecular formula C30H28N2O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 5-[(1E,6E)-7-[2-methoxy-4-(pyridin-3-ylmethoxy)phenyl]-3,5-dimethylidenehepta-1,6-dienyl]-1H-indole.
| Compound Name | 5-[(1E,6E)-7-[2-methoxy-4-(pyridin-3-ylmethoxy)phenyl]-3,5-dimethylidenehepta-1,6-dienyl]-1H-indole |
|---|---|
| PubChem CID | 126635867 |
| Molecular Formula | C30H28N2O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 5-[(1E,6E)-7-[2-methoxy-4-(pyridin-3-ylmethoxy)phenyl]-3,5-dimethylidenehepta-1,6-dienyl]-1H-indole |
| SMILES | C=C(/C=C/c1ccc2[nH]ccc2c1)CC(=C)/C=C/c1ccc(OCc2cccnc2)cc1OC |
| InChI | InChI=1S/C30H28N2O2/c1-22(6-8-24-9-13-29-27(18-24)14-16-32-29)17-23(2)7-10-26-11-12-28(19-30(26)33-3)34-21-25-5-4-15-31-20-25/h4-16,18-20,32H,1-2,17,21H2,3H3/b8-6+,10-7+ |
| InChIKey | ONRUCIKDHRHMDH-NBANWCDVSA-N |
| XLogP | 7.38 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|