About 6,8-ditert-butyl-3-(phenylmethoxymethyl)-1,4-benzoxazin-2-one
6,8-ditert-butyl-3-(phenylmethoxymethyl)-1,4-benzoxazin-2-one (PubChem CID 126655784) has the molecular formula C24H29NO3
and a molecular weight of 379.50 g/mol. Its IUPAC name is 6,8-ditert-butyl-3-(phenylmethoxymethyl)-1,4-benzoxazin-2-one.
Molecular Properties
| Compound Name | 6,8-ditert-butyl-3-(phenylmethoxymethyl)-1,4-benzoxazin-2-one |
| PubChem CID | 126655784 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 6,8-ditert-butyl-3-(phenylmethoxymethyl)-1,4-benzoxazin-2-one |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc(=O)c(COCc3ccccc3)nc2c1 |
| InChI | InChI=1S/C24H29NO3/c1-23(2,3)17-12-18(24(4,5)6)21-19(13-17)25-20(22(26)28-21)15-27-14-16-10-8-7-9-11-16/h7-13H,14-15H2,1-6H3 |
| InChIKey | BKHSOQYNYCRXJA-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,8-ditert-butyl-3-(phenylmethoxymethyl)-1,4-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-ditert-butyl-3-(phenylmethoxymethyl)-1,4-benzoxazin-2-one?
The IUPAC name of 6,8-ditert-butyl-3-(phenylmethoxymethyl)-1,4-benzoxazin-2-one (CID 126655784) is 6,8-ditert-butyl-3-(phenylmethoxymethyl)-1,4-benzoxazin-2-one.
What is the SMILES notation for 6,8-ditert-butyl-3-(phenylmethoxymethyl)-1,4-benzoxazin-2-one?
The canonical SMILES for 6,8-ditert-butyl-3-(phenylmethoxymethyl)-1,4-benzoxazin-2-one is CC(C)(C)c1cc(C(C)(C)C)c2oc(=O)c(COCc3ccccc3)nc2c1.
What is the InChIKey of 6,8-ditert-butyl-3-(phenylmethoxymethyl)-1,4-benzoxazin-2-one?
The InChIKey is BKHSOQYNYCRXJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29NO3/c1-23(2,3)17-12-18(24(4,5)6)21-19(13-17)25-20(22(26)28-21)15-27-14-16-10-8-7-9-11-16/h7-13H,14-15H2,1-6H3.
What are the key properties of 6,8-ditert-butyl-3-(phenylmethoxymethyl)-1,4-benzoxazin-2-one?
6,8-ditert-butyl-3-(phenylmethoxymethyl)-1,4-benzoxazin-2-one has a molecular weight of 379.50 g/mol, XLogP of 5.50, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-ditert-butyl-3-(phenylmethoxymethyl)-1,4-benzoxazin-2-one is sourced from PubChem (CID 126655784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).