C11H25N3 — CID 126658213
(5S)-3,4-ditert-butyl-5-methyl-1,2,4-triazolidine (PubChem CID 126658213) has the molecular formula C11H25N3 and a molecular weight of 199.34 g/mol. Its IUPAC name is (5S)-3,4-ditert-butyl-5-methyl-1,2,4-triazolidine.
| Compound Name | (5S)-3,4-ditert-butyl-5-methyl-1,2,4-triazolidine |
|---|---|
| PubChem CID | 126658213 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | (5S)-3,4-ditert-butyl-5-methyl-1,2,4-triazolidine |
| SMILES | C[C@@H]1NNC(C(C)(C)C)N1C(C)(C)C |
| InChI | InChI=1S/C11H25N3/c1-8-12-13-9(10(2,3)4)14(8)11(5,6)7/h8-9,12-13H,1-7H3/t8-,9?/m1/s1 |
| InChIKey | XMSWWWKMNFWQNB-VEDVMXKPSA-N |
| XLogP | 1.91 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |