C27H29Cl2F3N6O8S — CID 126666423
tert-butyl 2-[[2-[(7R,8R,9R)-7-(2-amino-6-chloropurin-9-yl)-9-[(4-chlorophenyl)methoxy]-3,3-dioxo-2,6-dioxa-3λ6-thiaspiro[4.4]nonan-8-yl]acetyl]amino]-3,3,3-trifluoropropanoate (PubChem CID 126666423) has the molecular formula C27H29Cl2F3N6O8S and a molecular weight of 725.53 g/mol. Its IUPAC name is tert-butyl 2-[[2-[(7R,8R,9R)-7-(2-amino-6-chloropurin-9-yl)-9-[(4-chlorophenyl)methoxy]-3,3-dioxo-2,6-dioxa-3λ6-thiaspiro[4.4]nonan-8-yl]acetyl]amino]-3,3,3-trifluoropropanoate.
| Compound Name | tert-butyl 2-[[2-[(7R,8R,9R)-7-(2-amino-6-chloropurin-9-yl)-9-[(4-chlorophenyl)methoxy]-3,3-dioxo-2,6-dioxa-3λ6-thiaspiro[4.4]nonan-8-yl]acetyl]amino]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 126666423 |
| Molecular Formula | C27H29Cl2F3N6O8S |
| Molecular Weight | 725.53 g/mol |
| Exact Mass | 724.11 |
| IUPAC Name | tert-butyl 2-[[2-[(7R,8R,9R)-7-(2-amino-6-chloropurin-9-yl)-9-[(4-chlorophenyl)methoxy]-3,3-dioxo-2,6-dioxa-3λ6-thiaspiro[4.4]nonan-8-yl]acetyl]amino]-3,3,3-trifluoropropanoate |
| SMILES | CC(C)(C)OC(=O)C(NC(=O)C[C@H]1[C@H](n2cnc3c(Cl)nc(N)nc32)OC2(COS(=O)(=O)C2)[C@@H]1OCc1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C27H29Cl2F3N6O8S/c1-25(2,3)46-23(40)18(27(30,31)32)35-16(39)8-15-19(43-9-13-4-6-14(28)7-5-13)26(10-44-47(41,42)11-26)45-22(15)38-12-34-17-20(29)36-24(33)37-21(17)38/h4-7,12,15,18-19,22H,8-11H2,1-3H3,(H,35,39)(H2,33,36,37)/t15-,18?,19-,22-,26?/m1/s1 |
| InChIKey | IDWFIXZGVHXLEZ-CXYZEPTOSA-N |
| XLogP | 3.32 |
| TPSA | 186.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|