C31H33ClN6O8S — CID 126666373
tert-butyl N-[[(7R,8R,9S)-7-(6-benzamidopurin-9-yl)-9-[(4-chlorophenyl)methoxy]-3,3-dioxo-2,6-dioxa-3λ6-thiaspiro[4.4]nonan-8-yl]methyl]carbamate (PubChem CID 126666373) has the molecular formula C31H33ClN6O8S and a molecular weight of 685.16 g/mol. Its IUPAC name is tert-butyl N-[[(7R,8R,9S)-7-(6-benzamidopurin-9-yl)-9-[(4-chlorophenyl)methoxy]-3,3-dioxo-2,6-dioxa-3λ6-thiaspiro[4.4]nonan-8-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(7R,8R,9S)-7-(6-benzamidopurin-9-yl)-9-[(4-chlorophenyl)methoxy]-3,3-dioxo-2,6-dioxa-3λ6-thiaspiro[4.4]nonan-8-yl]methyl]carbamate |
|---|---|
| PubChem CID | 126666373 |
| Molecular Formula | C31H33ClN6O8S |
| Molecular Weight | 685.16 g/mol |
| Exact Mass | 684.18 |
| IUPAC Name | tert-butyl N-[[(7R,8R,9S)-7-(6-benzamidopurin-9-yl)-9-[(4-chlorophenyl)methoxy]-3,3-dioxo-2,6-dioxa-3λ6-thiaspiro[4.4]nonan-8-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)OC2(COS(=O)(=O)C2)[C@H]1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H33ClN6O8S/c1-30(2,3)46-29(40)33-13-22-24(43-14-19-9-11-21(32)12-10-19)31(15-44-47(41,42)16-31)45-28(22)38-18-36-23-25(34-17-35-26(23)38)37-27(39)20-7-5-4-6-8-20/h4-12,17-18,22,24,28H,13-16H2,1-3H3,(H,33,40)(H,34,35,37,39)/t22-,24+,28-,31?/m1/s1 |
| InChIKey | CYUDAWOJROAEPE-GYJVCEMUSA-N |
| XLogP | 4.09 |
| TPSA | 172.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.16 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|