C27H28N6O7S — CID 87122339
[(1R,3R,4R,7S)-3-(6-benzamidopurin-9-yl)-6-(methylamino)-7-phenylmethoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methyl methanesulfonate (PubChem CID 87122339) has the molecular formula C27H28N6O7S and a molecular weight of 580.62 g/mol. Its IUPAC name is [(1R,3R,4R,7S)-3-(6-benzamidopurin-9-yl)-6-(methylamino)-7-phenylmethoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methyl methanesulfonate.
| Compound Name | [(1R,3R,4R,7S)-3-(6-benzamidopurin-9-yl)-6-(methylamino)-7-phenylmethoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 87122339 |
| Molecular Formula | C27H28N6O7S |
| Molecular Weight | 580.62 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | [(1R,3R,4R,7S)-3-(6-benzamidopurin-9-yl)-6-(methylamino)-7-phenylmethoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methyl methanesulfonate |
| SMILES | CNC1O[C@H]2[C@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)O[C@]1(COS(C)(=O)=O)[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C27H28N6O7S/c1-28-26-27(14-38-41(2,35)36)21(37-13-17-9-5-3-6-10-17)20(39-26)25(40-27)33-16-31-19-22(29-15-30-23(19)33)32-24(34)18-11-7-4-8-12-18/h3-12,15-16,20-21,25-26,28H,13-14H2,1-2H3,(H,29,30,32,34)/t20-,21+,25-,26?,27-/m1/s1 |
| InChIKey | CMEHKDRHTQDKIG-NCNRZHCSSA-N |
| XLogP | 1.85 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.62 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|