C39H48N2O4 — CID 126669290
benzyl N-[2-[(2-butoxy-3-trityloxypropyl)-propylamino]ethyl]carbamate (PubChem CID 126669290) has the molecular formula C39H48N2O4 and a molecular weight of 608.82 g/mol. Its IUPAC name is benzyl N-[2-[(2-butoxy-3-trityloxypropyl)-propylamino]ethyl]carbamate.
| Compound Name | benzyl N-[2-[(2-butoxy-3-trityloxypropyl)-propylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 126669290 |
| Molecular Formula | C39H48N2O4 |
| Molecular Weight | 608.82 g/mol |
| Exact Mass | 608.36 |
| IUPAC Name | benzyl N-[2-[(2-butoxy-3-trityloxypropyl)-propylamino]ethyl]carbamate |
| SMILES | CCCCOC(COC(c1ccccc1)(c1ccccc1)c1ccccc1)CN(CCC)CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C39H48N2O4/c1-3-5-29-43-37(30-41(27-4-2)28-26-40-38(42)44-31-33-18-10-6-11-19-33)32-45-39(34-20-12-7-13-21-34,35-22-14-8-15-23-35)36-24-16-9-17-25-36/h6-25,37H,3-5,26-32H2,1-2H3,(H,40,42) |
| InChIKey | ASGKBKAVNHBKBL-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.82 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|