C16H20N2OS — CID 126670619
2,4-di(propan-2-yl)thieno[2,3-b][1,4]benzoxazin-3-amine (PubChem CID 126670619) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is 2,4-di(propan-2-yl)thieno[2,3-b][1,4]benzoxazin-3-amine.
| Compound Name | 2,4-di(propan-2-yl)thieno[2,3-b][1,4]benzoxazin-3-amine |
|---|---|
| PubChem CID | 126670619 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2,4-di(propan-2-yl)thieno[2,3-b][1,4]benzoxazin-3-amine |
| SMILES | CC(C)c1sc2c(c1N)N(C(C)C)c1ccccc1O2 |
| InChI | InChI=1S/C16H20N2OS/c1-9(2)15-13(17)14-16(20-15)19-12-8-6-5-7-11(12)18(14)10(3)4/h5-10H,17H2,1-4H3 |
| InChIKey | IVIVUIOIFUGWLQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |