C24H34ClFN6O5 — CID 126678586
(3-chlorophenyl)methyl N-[1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-2-methyl-1-oxopropan-2-yl]carbamate (PubChem CID 126678586) has the molecular formula C24H34ClFN6O5 and a molecular weight of 541.02 g/mol. Its IUPAC name is (3-chlorophenyl)methyl N-[1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-2-methyl-1-oxopropan-2-yl]carbamate.
| Compound Name | (3-chlorophenyl)methyl N-[1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-2-methyl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 126678586 |
| Molecular Formula | C24H34ClFN6O5 |
| Molecular Weight | 541.02 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | (3-chlorophenyl)methyl N-[1-[(2S)-2-[[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-2-methyl-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(NC(=O)OCc1cccc(Cl)c1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)CF |
| InChI | InChI=1S/C24H34ClFN6O5/c1-24(2,31-23(36)37-14-15-6-3-7-16(25)12-15)21(35)32-11-5-9-18(32)20(34)30-17(19(33)13-26)8-4-10-29-22(27)28/h3,6-7,12,17-18H,4-5,8-11,13-14H2,1-2H3,(H,30,34)(H,31,36)(H4,27,28,29)/t17-,18-/m0/s1 |
| InChIKey | BSBIIRDXIAFYDV-ROUUACIJSA-N |
| XLogP | 1.41 |
| TPSA | 169.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.02 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|