About 1,1-dimethyl-2,3,4,7a-tetrahydrocyclopenta[b]thiopyran
1,1-dimethyl-2,3,4,7a-tetrahydrocyclopenta[b]thiopyran (PubChem CID 126684443) has the molecular formula C10H16S
and a molecular weight of 168.31 g/mol. Its IUPAC name is 1,1-dimethyl-2,3,4,7a-tetrahydrocyclopenta[b]thiopyran.
Analyze 1,1-dimethyl-2,3,4,7a-tetrahydrocyclopenta[b]thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-2,3,4,7a-tetrahydrocyclopenta[b]thiopyran?
The IUPAC name of 1,1-dimethyl-2,3,4,7a-tetrahydrocyclopenta[b]thiopyran (CID 126684443) is 1,1-dimethyl-2,3,4,7a-tetrahydrocyclopenta[b]thiopyran.
What is the SMILES notation for 1,1-dimethyl-2,3,4,7a-tetrahydrocyclopenta[b]thiopyran?
The canonical SMILES for 1,1-dimethyl-2,3,4,7a-tetrahydrocyclopenta[b]thiopyran is CS1(C)CCCC2=CC=CC21.
What is the InChIKey of 1,1-dimethyl-2,3,4,7a-tetrahydrocyclopenta[b]thiopyran?
The InChIKey is ZMHXHPXMNNLOKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16S/c1-11(2)8-4-6-9-5-3-7-10(9)11/h3,5,7,10H,4,6,8H2,1-2H3.
What are the key properties of 1,1-dimethyl-2,3,4,7a-tetrahydrocyclopenta[b]thiopyran?
1,1-dimethyl-2,3,4,7a-tetrahydrocyclopenta[b]thiopyran has a molecular weight of 168.31 g/mol, XLogP of 2.71, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-2,3,4,7a-tetrahydrocyclopenta[b]thiopyran is sourced from PubChem (CID 126684443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).