C24H24N2O3 — CID 126702693
N,4-diphenyl-1-(3,4,5-trimethoxyphenyl)azetidin-2-imine (PubChem CID 126702693) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is N,4-diphenyl-1-(3,4,5-trimethoxyphenyl)azetidin-2-imine.
| Compound Name | N,4-diphenyl-1-(3,4,5-trimethoxyphenyl)azetidin-2-imine |
|---|---|
| PubChem CID | 126702693 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N,4-diphenyl-1-(3,4,5-trimethoxyphenyl)azetidin-2-imine |
| SMILES | COc1cc(N2/C(=N/c3ccccc3)CC2c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H24N2O3/c1-27-21-14-19(15-22(28-2)24(21)29-3)26-20(17-10-6-4-7-11-17)16-23(26)25-18-12-8-5-9-13-18/h4-15,20H,16H2,1-3H3/b25-23+ |
| InChIKey | UAZHPECELNHBFJ-WJTDDFOZSA-N |
| XLogP | 5.39 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|