C24H23F4N3O5S — CID 126737949
[4-(trifluoromethoxy)phenyl]methyl 6-(2-fluoro-4-sulfinamoylbenzoyl)-1,3,4,5,7,8-hexahydro-2,6-naphthyridine-2-carboxylate (PubChem CID 126737949) has the molecular formula C24H23F4N3O5S and a molecular weight of 541.52 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl]methyl 6-(2-fluoro-4-sulfinamoylbenzoyl)-1,3,4,5,7,8-hexahydro-2,6-naphthyridine-2-carboxylate.
| Compound Name | [4-(trifluoromethoxy)phenyl]methyl 6-(2-fluoro-4-sulfinamoylbenzoyl)-1,3,4,5,7,8-hexahydro-2,6-naphthyridine-2-carboxylate |
|---|---|
| PubChem CID | 126737949 |
| Molecular Formula | C24H23F4N3O5S |
| Molecular Weight | 541.52 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl]methyl 6-(2-fluoro-4-sulfinamoylbenzoyl)-1,3,4,5,7,8-hexahydro-2,6-naphthyridine-2-carboxylate |
| SMILES | NS(=O)c1ccc(C(=O)N2CCC3=C(CCN(C(=O)OCc4ccc(OC(F)(F)F)cc4)C3)C2)c(F)c1 |
| InChI | InChI=1S/C24H23F4N3O5S/c25-21-11-19(37(29)34)5-6-20(21)22(32)30-9-7-17-13-31(10-8-16(17)12-30)23(33)35-14-15-1-3-18(4-2-15)36-24(26,27)28/h1-6,11H,7-10,12-14,29H2 |
| InChIKey | PMDRBJLESUVFLF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|