C5H12O5S — CID 126740843
2-hydroxyethanethioic S-acid;propane-1,2,3-triol (PubChem CID 126740843) has the molecular formula C5H12O5S and a molecular weight of 184.21 g/mol. Its IUPAC name is 2-hydroxyethanethioic S-acid;propane-1,2,3-triol.
| Compound Name | 2-hydroxyethanethioic S-acid;propane-1,2,3-triol |
|---|---|
| PubChem CID | 126740843 |
| Molecular Formula | C5H12O5S |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 2-hydroxyethanethioic S-acid;propane-1,2,3-triol |
| SMILES | O=C(S)CO.OCC(O)CO |
| InChI | InChI=1S/C3H8O3.C2H4O2S/c4-1-3(6)2-5;3-1-2(4)5/h3-6H,1-2H2;3H,1H2,(H,4,5) |
| InChIKey | OZAWOGZSXCJURX-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|