C19H25N — CID 126746262
N-[(2Z,4E,6E)-7-(4-tert-butylphenyl)-5-methylhepta-2,4,6-trien-2-yl]methanimine (PubChem CID 126746262) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is N-[(2Z,4E,6E)-7-(4-tert-butylphenyl)-5-methylhepta-2,4,6-trien-2-yl]methanimine.
| Compound Name | N-[(2Z,4E,6E)-7-(4-tert-butylphenyl)-5-methylhepta-2,4,6-trien-2-yl]methanimine |
|---|---|
| PubChem CID | 126746262 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | N-[(2Z,4E,6E)-7-(4-tert-butylphenyl)-5-methylhepta-2,4,6-trien-2-yl]methanimine |
| SMILES | C=N/C(C)=C\C=C(C)\C=C\c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H25N/c1-15(7-9-16(2)20-6)8-10-17-11-13-18(14-12-17)19(3,4)5/h7-14H,6H2,1-5H3/b10-8+,15-7+,16-9- |
| InChIKey | YHSWJSNMTLIKGX-PBKQAORYSA-N |
| XLogP | 5.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|