C23H26N2O3 — CID 126749068
methyl 4-[[(2R)-2-methylbut-3-enoyl]amino]-3-[2-[(2S)-pent-4-en-2-yl]-4-pyridinyl]benzoate (PubChem CID 126749068) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is methyl 4-[[(2R)-2-methylbut-3-enoyl]amino]-3-[2-[(2S)-pent-4-en-2-yl]-4-pyridinyl]benzoate.
| Compound Name | methyl 4-[[(2R)-2-methylbut-3-enoyl]amino]-3-[2-[(2S)-pent-4-en-2-yl]-4-pyridinyl]benzoate |
|---|---|
| PubChem CID | 126749068 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | methyl 4-[[(2R)-2-methylbut-3-enoyl]amino]-3-[2-[(2S)-pent-4-en-2-yl]-4-pyridinyl]benzoate |
| SMILES | C=CC[C@H](C)c1cc(-c2cc(C(=O)OC)ccc2NC(=O)[C@H](C)C=C)ccn1 |
| InChI | InChI=1S/C23H26N2O3/c1-6-8-16(4)21-14-17(11-12-24-21)19-13-18(23(27)28-5)9-10-20(19)25-22(26)15(3)7-2/h6-7,9-16H,1-2,8H2,3-5H3,(H,25,26)/t15-,16+/m1/s1 |
| InChIKey | MDCHUSWKBZHQIB-CVEARBPZSA-N |
| XLogP | 4.98 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|