C21H33NO4 — CID 126787310
4-[(2,4-dipropoxyphenyl)methyl]-1,9-dioxa-4-azaspiro[5.5]undecane (PubChem CID 126787310) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is 4-[(2,4-dipropoxyphenyl)methyl]-1,9-dioxa-4-azaspiro[5.5]undecane.
| Compound Name | 4-[(2,4-dipropoxyphenyl)methyl]-1,9-dioxa-4-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 126787310 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 4-[(2,4-dipropoxyphenyl)methyl]-1,9-dioxa-4-azaspiro[5.5]undecane |
| SMILES | CCCOc1ccc(CN2CCOC3(CCOCC3)C2)c(OCCC)c1 |
| InChI | InChI=1S/C21H33NO4/c1-3-10-24-19-6-5-18(20(15-19)25-11-4-2)16-22-9-14-26-21(17-22)7-12-23-13-8-21/h5-6,15H,3-4,7-14,16-17H2,1-2H3 |
| InChIKey | JSMAHQRPSJBFFB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |