C19H13ClN4O5 — CID 126817089
N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methylideneamino]-2-(3-nitrophenyl)acetamide (PubChem CID 126817089) has the molecular formula C19H13ClN4O5 and a molecular weight of 412.79 g/mol. Its IUPAC name is N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methylideneamino]-2-(3-nitrophenyl)acetamide.
| Compound Name | N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methylideneamino]-2-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126817089 |
| Molecular Formula | C19H13ClN4O5 |
| Molecular Weight | 412.79 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methylideneamino]-2-(3-nitrophenyl)acetamide |
| SMILES | O=C(Cc1cccc([N+](=O)[O-])c1)NN=Cc1cc2cc3c(cc2nc1Cl)OCO3 |
| InChI | InChI=1S/C19H13ClN4O5/c20-19-13(6-12-7-16-17(29-10-28-16)8-15(12)22-19)9-21-23-18(25)5-11-2-1-3-14(4-11)24(26)27/h1-4,6-9H,5,10H2,(H,23,25) |
| InChIKey | NIHMSBHIDVAUQE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.79 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|