C15H24N2O4S — CID 126817607
N'-[2-(2,6-dimethylphenoxy)ethoxy]-3-ethylsulfonylpropanimidamide (PubChem CID 126817607) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is N'-[2-(2,6-dimethylphenoxy)ethoxy]-3-ethylsulfonylpropanimidamide.
| Compound Name | N'-[2-(2,6-dimethylphenoxy)ethoxy]-3-ethylsulfonylpropanimidamide |
|---|---|
| PubChem CID | 126817607 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N'-[2-(2,6-dimethylphenoxy)ethoxy]-3-ethylsulfonylpropanimidamide |
| SMILES | CCS(=O)(=O)CCC(N)=NOCCOc1c(C)cccc1C |
| InChI | InChI=1S/C15H24N2O4S/c1-4-22(18,19)11-8-14(16)17-21-10-9-20-15-12(2)6-5-7-13(15)3/h5-7H,4,8-11H2,1-3H3,(H2,16,17) |
| InChIKey | NOZNUZFAAJXNTA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|