C17H20FNO4 — CID 126818997
methyl 2-[(3-fluoro-4-hydroxyphenyl)methyl]-3-(hexa-2,4-dienoylamino)propanoate (PubChem CID 126818997) has the molecular formula C17H20FNO4 and a molecular weight of 321.35 g/mol. Its IUPAC name is methyl 2-[(3-fluoro-4-hydroxyphenyl)methyl]-3-(hexa-2,4-dienoylamino)propanoate.
| Compound Name | methyl 2-[(3-fluoro-4-hydroxyphenyl)methyl]-3-(hexa-2,4-dienoylamino)propanoate |
|---|---|
| PubChem CID | 126818997 |
| Molecular Formula | C17H20FNO4 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | methyl 2-[(3-fluoro-4-hydroxyphenyl)methyl]-3-(hexa-2,4-dienoylamino)propanoate |
| SMILES | CC=CC=CC(=O)NCC(Cc1ccc(O)c(F)c1)C(=O)OC |
| InChI | InChI=1S/C17H20FNO4/c1-3-4-5-6-16(21)19-11-13(17(22)23-2)9-12-7-8-15(20)14(18)10-12/h3-8,10,13,20H,9,11H2,1-2H3,(H,19,21) |
| InChIKey | AIZRVSSUBPEUDS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|