C17H13F6NO5S — CID 167878890
methyl 2-[(3-fluoro-4-hydroxyphenyl)methyl]-3-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoate (PubChem CID 167878890) has the molecular formula C17H13F6NO5S and a molecular weight of 457.35 g/mol. Its IUPAC name is methyl 2-[(3-fluoro-4-hydroxyphenyl)methyl]-3-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoate.
| Compound Name | methyl 2-[(3-fluoro-4-hydroxyphenyl)methyl]-3-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 167878890 |
| Molecular Formula | C17H13F6NO5S |
| Molecular Weight | 457.35 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | methyl 2-[(3-fluoro-4-hydroxyphenyl)methyl]-3-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)C(CNS(=O)(=O)c1c(F)c(F)c(F)c(F)c1F)Cc1ccc(O)c(F)c1 |
| InChI | InChI=1S/C17H13F6NO5S/c1-29-17(26)8(4-7-2-3-10(25)9(18)5-7)6-24-30(27,28)16-14(22)12(20)11(19)13(21)15(16)23/h2-3,5,8,24-25H,4,6H2,1H3 |
| InChIKey | XGCFLPLVWVXREY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|