C12H13N7O2S — CID 126840175
N'-(3-methyl-5-nitroimidazol-4-yl)-N-thieno[2,3-d]pyrimidin-4-ylethane-1,2-diamine (PubChem CID 126840175) has the molecular formula C12H13N7O2S and a molecular weight of 319.35 g/mol. Its IUPAC name is N'-(3-methyl-5-nitroimidazol-4-yl)-N-thieno[2,3-d]pyrimidin-4-ylethane-1,2-diamine.
| Compound Name | N'-(3-methyl-5-nitroimidazol-4-yl)-N-thieno[2,3-d]pyrimidin-4-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 126840175 |
| Molecular Formula | C12H13N7O2S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N'-(3-methyl-5-nitroimidazol-4-yl)-N-thieno[2,3-d]pyrimidin-4-ylethane-1,2-diamine |
| SMILES | Cn1cnc([N+](=O)[O-])c1NCCNc1ncnc2sccc12 |
| InChI | InChI=1S/C12H13N7O2S/c1-18-7-17-11(19(20)21)10(18)14-4-3-13-9-8-2-5-22-12(8)16-6-15-9/h2,5-7,14H,3-4H2,1H3,(H,13,15,16) |
| InChIKey | OJTHATMRHFSDSF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|