C13H21N5O — CID 126900349
1-[2-(3-pyrazol-1-ylazetidin-1-yl)ethyl]-1,4-diazepan-5-one (PubChem CID 126900349) has the molecular formula C13H21N5O and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-[2-(3-pyrazol-1-ylazetidin-1-yl)ethyl]-1,4-diazepan-5-one.
| Compound Name | 1-[2-(3-pyrazol-1-ylazetidin-1-yl)ethyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 126900349 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 1-[2-(3-pyrazol-1-ylazetidin-1-yl)ethyl]-1,4-diazepan-5-one |
| SMILES | O=C1CCN(CCN2CC(n3cccn3)C2)CCN1 |
| InChI | InChI=1S/C13H21N5O/c19-13-2-6-16(7-4-14-13)8-9-17-10-12(11-17)18-5-1-3-15-18/h1,3,5,12H,2,4,6-11H2,(H,14,19) |
| InChIKey | XPEFYZOJJWPGHD-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |