About 2'-methylspiro[adamantane-2,3'-oxaziridine]
2'-methylspiro[adamantane-2,3'-oxaziridine] (PubChem CID 12693707) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 2'-methylspiro[adamantane-2,3'-oxaziridine].
Molecular Properties
| Compound Name | 2'-methylspiro[adamantane-2,3'-oxaziridine] |
| PubChem CID | 12693707 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2'-methylspiro[adamantane-2,3'-oxaziridine] |
| SMILES | CN1OC12C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C11H17NO/c1-12-11(13-12)9-3-7-2-8(5-9)6-10(11)4-7/h7-10H,2-6H2,1H3 |
| InChIKey | MZCYNUWMBYPIMX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 15.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2'-methylspiro[adamantane-2,3'-oxaziridine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-methylspiro[adamantane-2,3'-oxaziridine]?
The IUPAC name of 2'-methylspiro[adamantane-2,3'-oxaziridine] (CID 12693707) is 2'-methylspiro[adamantane-2,3'-oxaziridine].
What is the SMILES notation for 2'-methylspiro[adamantane-2,3'-oxaziridine]?
The canonical SMILES for 2'-methylspiro[adamantane-2,3'-oxaziridine] is CN1OC12C1CC3CC(C1)CC2C3.
What is the InChIKey of 2'-methylspiro[adamantane-2,3'-oxaziridine]?
The InChIKey is MZCYNUWMBYPIMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-12-11(13-12)9-3-7-2-8(5-9)6-10(11)4-7/h7-10H,2-6H2,1H3.
What are the key properties of 2'-methylspiro[adamantane-2,3'-oxaziridine]?
2'-methylspiro[adamantane-2,3'-oxaziridine] has a molecular weight of 179.26 g/mol, XLogP of 2.02, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-methylspiro[adamantane-2,3'-oxaziridine] is sourced from PubChem (CID 12693707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).