C18H18BrN2OS+ — CID 126956905
5-(4-methoxyphenyl)-7-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium;hydrobromide (PubChem CID 126956905) has the molecular formula C18H18BrN2OS+ and a molecular weight of 390.33 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-7-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium;hydrobromide.
| Compound Name | 5-(4-methoxyphenyl)-7-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium;hydrobromide |
|---|---|
| PubChem CID | 126956905 |
| Molecular Formula | C18H18BrN2OS+ |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 5-(4-methoxyphenyl)-7-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium;hydrobromide |
| SMILES | Br.COc1ccc(-c2cn(-c3ccccc3)c3[n+]2CCS3)cc1 |
| InChI | InChI=1S/C18H17N2OS.BrH/c1-21-16-9-7-14(8-10-16)17-13-20(15-5-3-2-4-6-15)18-19(17)11-12-22-18;/h2-10,13H,11-12H2,1H3;1H/q+1; |
| InChIKey | MZUKPFKYRPXKFS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|