C20H18BrN2O+ — CID 126958144
3-(4-methoxyphenyl)-1-phenylimidazo[1,2-a]pyridin-4-ium;hydrobromide (PubChem CID 126958144) has the molecular formula C20H18BrN2O+ and a molecular weight of 382.28 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-phenylimidazo[1,2-a]pyridin-4-ium;hydrobromide.
| Compound Name | 3-(4-methoxyphenyl)-1-phenylimidazo[1,2-a]pyridin-4-ium;hydrobromide |
|---|---|
| PubChem CID | 126958144 |
| Molecular Formula | C20H18BrN2O+ |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-phenylimidazo[1,2-a]pyridin-4-ium;hydrobromide |
| SMILES | Br.COc1ccc(-c2cn(-c3ccccc3)c3cccc[n+]23)cc1 |
| InChI | InChI=1S/C20H17N2O.BrH/c1-23-18-12-10-16(11-13-18)19-15-22(17-7-3-2-4-8-17)20-9-5-6-14-21(19)20;/h2-15H,1H3;1H/q+1; |
| InChIKey | JCOPBKOVDSONKH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 18.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|