C34H30BrClN2P+ — CID 126958934
[(2E)-2-[[(4-chlorophenyl)-phenylmethylidene]hydrazinylidene]propyl]-triphenylphosphanium;hydrobromide (PubChem CID 126958934) has the molecular formula C34H30BrClN2P+ and a molecular weight of 612.96 g/mol. Its IUPAC name is [(2E)-2-[[(4-chlorophenyl)-phenylmethylidene]hydrazinylidene]propyl]-triphenylphosphanium;hydrobromide.
| Compound Name | [(2E)-2-[[(4-chlorophenyl)-phenylmethylidene]hydrazinylidene]propyl]-triphenylphosphanium;hydrobromide |
|---|---|
| PubChem CID | 126958934 |
| Molecular Formula | C34H30BrClN2P+ |
| Molecular Weight | 612.96 g/mol |
| Exact Mass | 611.10 |
| IUPAC Name | [(2E)-2-[[(4-chlorophenyl)-phenylmethylidene]hydrazinylidene]propyl]-triphenylphosphanium;hydrobromide |
| SMILES | Br.C/C(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)=N\N=C(c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C34H29ClN2P.BrH/c1-27(36-37-34(28-14-6-2-7-15-28)29-22-24-30(35)25-23-29)26-38(31-16-8-3-9-17-31,32-18-10-4-11-19-32)33-20-12-5-13-21-33;/h2-25H,26H2,1H3;1H/q+1;/b36-27+,37-34?; |
| InChIKey | HCTJLPNXPLDFHH-JFPINQQSSA-N |
| XLogP | 8.13 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.96 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|