C34H29ClN2P+ — CID 99078907
[(2E)-2-[(E)-[(4-chlorophenyl)-phenylmethylidene]hydrazinylidene]propyl]-triphenylphosphanium (PubChem CID 99078907) has the molecular formula C34H29ClN2P+ and a molecular weight of 532.05 g/mol. Its IUPAC name is [(2E)-2-[(E)-[(4-chlorophenyl)-phenylmethylidene]hydrazinylidene]propyl]-triphenylphosphanium.
| Compound Name | [(2E)-2-[(E)-[(4-chlorophenyl)-phenylmethylidene]hydrazinylidene]propyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 99078907 |
| Molecular Formula | C34H29ClN2P+ |
| Molecular Weight | 532.05 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | [(2E)-2-[(E)-[(4-chlorophenyl)-phenylmethylidene]hydrazinylidene]propyl]-triphenylphosphanium |
| SMILES | C/C(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)=N\N=C(/c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C34H29ClN2P/c1-27(36-37-34(28-14-6-2-7-15-28)29-22-24-30(35)25-23-29)26-38(31-16-8-3-9-17-31,32-18-10-4-11-19-32)33-20-12-5-13-21-33/h2-25H,26H2,1H3/q+1/b36-27+,37-34+ |
| InChIKey | KVGYLDXZIDJRSR-KPYIJLJTSA-N |
| XLogP | 7.55 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.05 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|