C20H17N3 — CID 127032409
(6S,6aR,11bR)-6-pyridin-4-yl-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c][1,5]naphthyridine (PubChem CID 127032409) has the molecular formula C20H17N3 and a molecular weight of 299.38 g/mol. Its IUPAC name is (6S,6aR,11bR)-6-pyridin-4-yl-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c][1,5]naphthyridine.
| Compound Name | (6S,6aR,11bR)-6-pyridin-4-yl-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c][1,5]naphthyridine |
|---|---|
| PubChem CID | 127032409 |
| Molecular Formula | C20H17N3 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (6S,6aR,11bR)-6-pyridin-4-yl-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c][1,5]naphthyridine |
| SMILES | c1ccc2c(c1)C[C@@H]1[C@H]2c2ncccc2N[C@@H]1c1ccncc1 |
| InChI | InChI=1S/C20H17N3/c1-2-5-15-14(4-1)12-16-18(15)20-17(6-3-9-22-20)23-19(16)13-7-10-21-11-8-13/h1-11,16,18-19,23H,12H2/t16-,18+,19-/m1/s1 |
| InChIKey | SBKBZHVNXNQAQY-NZSAHSFTSA-N |
| XLogP | 3.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |