C16H16N2 — CID 46217840
(6R,6aR,11bR)-6-methyl-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c][1,5]naphthyridine (PubChem CID 46217840) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is (6R,6aR,11bR)-6-methyl-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c][1,5]naphthyridine.
| Compound Name | (6R,6aR,11bR)-6-methyl-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c][1,5]naphthyridine |
|---|---|
| PubChem CID | 46217840 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (6R,6aR,11bR)-6-methyl-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c][1,5]naphthyridine |
| SMILES | C[C@H]1Nc2cccnc2[C@H]2c3ccccc3C[C@H]21 |
| InChI | InChI=1S/C16H16N2/c1-10-13-9-11-5-2-3-6-12(11)15(13)16-14(18-10)7-4-8-17-16/h2-8,10,13,15,18H,9H2,1H3/t10-,13+,15+/m1/s1 |
| InChIKey | HCEYKVUOGKQEMT-DGFSRKRXSA-N |
| XLogP | 3.20 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |