C12H14N2 — CID 75151942
6-methyl-6,6a,7,9a-tetrahydro-5H-cyclopenta[c][1,5]naphthyridine (PubChem CID 75151942) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 6-methyl-6,6a,7,9a-tetrahydro-5H-cyclopenta[c][1,5]naphthyridine.
| Compound Name | 6-methyl-6,6a,7,9a-tetrahydro-5H-cyclopenta[c][1,5]naphthyridine |
|---|---|
| PubChem CID | 75151942 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 6-methyl-6,6a,7,9a-tetrahydro-5H-cyclopenta[c][1,5]naphthyridine |
| SMILES | CC1Nc2cccnc2C2C=CCC12 |
| InChI | InChI=1S/C12H14N2/c1-8-9-4-2-5-10(9)12-11(14-8)6-3-7-13-12/h2-3,5-10,14H,4H2,1H3 |
| InChIKey | TUTYVRFANAAXLA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|