C12H11ClN2 — CID 22958184
5-chloro-1,2,4a,10b-tetrahydro-1,10-phenanthroline (PubChem CID 22958184) has the molecular formula C12H11ClN2 and a molecular weight of 218.69 g/mol. Its IUPAC name is 5-chloro-1,2,4a,10b-tetrahydro-1,10-phenanthroline.
| Compound Name | 5-chloro-1,2,4a,10b-tetrahydro-1,10-phenanthroline |
|---|---|
| PubChem CID | 22958184 |
| Molecular Formula | C12H11ClN2 |
| Molecular Weight | 218.69 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 5-chloro-1,2,4a,10b-tetrahydro-1,10-phenanthroline |
| SMILES | ClC1=Cc2cccnc2C2NCC=CC12 |
| InChI | InChI=1S/C12H11ClN2/c13-10-7-8-3-1-5-14-11(8)12-9(10)4-2-6-15-12/h1-5,7,9,12,15H,6H2 |
| InChIKey | VOUVICGAKOPHMT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.69 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|