C10H12N2O — CID 163797861
6-methoxy-7,8-dihydroquinolin-8-amine (PubChem CID 163797861) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 6-methoxy-7,8-dihydroquinolin-8-amine.
| Compound Name | 6-methoxy-7,8-dihydroquinolin-8-amine |
|---|---|
| PubChem CID | 163797861 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 6-methoxy-7,8-dihydroquinolin-8-amine |
| SMILES | COC1=Cc2cccnc2C(N)C1 |
| InChI | InChI=1S/C10H12N2O/c1-13-8-5-7-3-2-4-12-10(7)9(11)6-8/h2-5,9H,6,11H2,1H3 |
| InChIKey | NCJVVQXCVJLLFF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |