C12H10N2 — CID 131966659
6a,10a-dihydrobenzo[h][1,6]naphthyridine (PubChem CID 131966659) has the molecular formula C12H10N2 and a molecular weight of 182.23 g/mol. Its IUPAC name is 6a,10a-dihydrobenzo[h][1,6]naphthyridine.
| Compound Name | 6a,10a-dihydrobenzo[h][1,6]naphthyridine |
|---|---|
| PubChem CID | 131966659 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 6a,10a-dihydrobenzo[h][1,6]naphthyridine |
| SMILES | C1=CC2N=Cc3cccnc3C2C=C1 |
| InChI | InChI=1S/C12H10N2/c1-2-6-11-10(5-1)12-9(8-14-11)4-3-7-13-12/h1-8,10-11H |
| InChIKey | SNIKKLLYAVIFCV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |