C7H7N4- — CID 163917603
1,4-dihydropyrido[3,2-d]pyrimidin-4-ylazanide (PubChem CID 163917603) has the molecular formula C7H7N4- and a molecular weight of 147.16 g/mol. Its IUPAC name is 1,4-dihydropyrido[3,2-d]pyrimidin-4-ylazanide.
| Compound Name | 1,4-dihydropyrido[3,2-d]pyrimidin-4-ylazanide |
|---|---|
| PubChem CID | 163917603 |
| Molecular Formula | C7H7N4- |
| Molecular Weight | 147.16 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 1,4-dihydropyrido[3,2-d]pyrimidin-4-ylazanide |
| SMILES | [NH-]C1N=CNc2cccnc21 |
| InChI | InChI=1S/C7H7N4/c8-7-6-5(10-4-11-7)2-1-3-9-6/h1-4,7-8H,(H,10,11)/q-1 |
| InChIKey | QXPRDNSVKOPGDR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.16 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |