C21H22BrN3O3S3 — CID 127032946
(8S)-N-[(E)-(2-bromophenyl)methylideneamino]-7-(4-methylphenyl)sulfonyl-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide (PubChem CID 127032946) has the molecular formula C21H22BrN3O3S3 and a molecular weight of 540.53 g/mol. Its IUPAC name is (8S)-N-[(E)-(2-bromophenyl)methylideneamino]-7-(4-methylphenyl)sulfonyl-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide.
| Compound Name | (8S)-N-[(E)-(2-bromophenyl)methylideneamino]-7-(4-methylphenyl)sulfonyl-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide |
|---|---|
| PubChem CID | 127032946 |
| Molecular Formula | C21H22BrN3O3S3 |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 539.00 |
| IUPAC Name | (8S)-N-[(E)-(2-bromophenyl)methylideneamino]-7-(4-methylphenyl)sulfonyl-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3(C[C@H]2C(=O)N/N=C/c2ccccc2Br)SCCS3)cc1 |
| InChI | InChI=1S/C21H22BrN3O3S3/c1-15-6-8-17(9-7-15)31(27,28)25-14-21(29-10-11-30-21)12-19(25)20(26)24-23-13-16-4-2-3-5-18(16)22/h2-9,13,19H,10-12,14H2,1H3,(H,24,26)/b23-13+/t19-/m0/s1 |
| InChIKey | ZQPCRUDVYIJNEM-QMFLXTPQSA-N |
| XLogP | 3.85 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|