C23H29NO4S — CID 1270421
4-(cyclohexylsulfanylmethyl)-N-(3,4,5-trimethoxyphenyl)benzamide (PubChem CID 1270421) has the molecular formula C23H29NO4S and a molecular weight of 415.56 g/mol. Its IUPAC name is 4-(cyclohexylsulfanylmethyl)-N-(3,4,5-trimethoxyphenyl)benzamide.
| Compound Name | 4-(cyclohexylsulfanylmethyl)-N-(3,4,5-trimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 1270421 |
| Molecular Formula | C23H29NO4S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 4-(cyclohexylsulfanylmethyl)-N-(3,4,5-trimethoxyphenyl)benzamide |
| SMILES | COc1cc(NC(=O)c2ccc(CSC3CCCCC3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H29NO4S/c1-26-20-13-18(14-21(27-2)22(20)28-3)24-23(25)17-11-9-16(10-12-17)15-29-19-7-5-4-6-8-19/h9-14,19H,4-8,15H2,1-3H3,(H,24,25) |
| InChIKey | ZZXWTXRSGBDHHY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |