C34H34N4O10 — CID 127047883
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[(3E)-2-oxo-3-[(E)-3-phenylprop-2-enylidene]indol-1-yl]methyl]triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 127047883) has the molecular formula C34H34N4O10 and a molecular weight of 658.66 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[(3E)-2-oxo-3-[(E)-3-phenylprop-2-enylidene]indol-1-yl]methyl]triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[(3E)-2-oxo-3-[(E)-3-phenylprop-2-enylidene]indol-1-yl]methyl]triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 127047883 |
| Molecular Formula | C34H34N4O10 |
| Molecular Weight | 658.66 g/mol |
| Exact Mass | 658.23 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[(3E)-2-oxo-3-[(E)-3-phenylprop-2-enylidene]indol-1-yl]methyl]triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(CN3C(=O)/C(=C/C=C/c4ccccc4)c4ccccc43)nn2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C34H34N4O10/c1-20(39)44-19-29-30(45-21(2)40)31(46-22(3)41)32(47-23(4)42)34(48-29)38-18-25(35-36-38)17-37-28-16-9-8-14-26(28)27(33(37)43)15-10-13-24-11-6-5-7-12-24/h5-16,18,29-32,34H,17,19H2,1-4H3/b13-10+,27-15+/t29-,30-,31+,32-,34-/m1/s1 |
| InChIKey | UUWPCUOLIISNAF-GEHLOEJCSA-N |
| XLogP | 3.18 |
| TPSA | 165.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.66 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|