C33H33N5O10 — CID 127045773
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[3-[(E)-3-oxo-3-pyridin-3-ylprop-1-enyl]indol-1-yl]methyl]triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 127045773) has the molecular formula C33H33N5O10 and a molecular weight of 659.65 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[3-[(E)-3-oxo-3-pyridin-3-ylprop-1-enyl]indol-1-yl]methyl]triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[3-[(E)-3-oxo-3-pyridin-3-ylprop-1-enyl]indol-1-yl]methyl]triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 127045773 |
| Molecular Formula | C33H33N5O10 |
| Molecular Weight | 659.65 g/mol |
| Exact Mass | 659.22 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[3-[(E)-3-oxo-3-pyridin-3-ylprop-1-enyl]indol-1-yl]methyl]triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(Cn3cc(/C=C/C(=O)c4cccnc4)c4ccccc43)nn2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C33H33N5O10/c1-19(39)44-18-29-30(45-20(2)40)31(46-21(3)41)32(47-22(4)42)33(48-29)38-17-25(35-36-38)16-37-15-24(26-9-5-6-10-27(26)37)11-12-28(43)23-8-7-13-34-14-23/h5-15,17,29-33H,16,18H2,1-4H3/b12-11+/t29-,30-,31+,32-,33-/m1/s1 |
| InChIKey | KHKQDJJQXIVNGL-LOCPBOMWSA-N |
| XLogP | 2.83 |
| TPSA | 180.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.65 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|