C30H30N4O11 — CID 127045885
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[(3Z)-3-(furan-2-ylmethylidene)-2-oxoindol-1-yl]methyl]triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 127045885) has the molecular formula C30H30N4O11 and a molecular weight of 622.59 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[(3Z)-3-(furan-2-ylmethylidene)-2-oxoindol-1-yl]methyl]triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[(3Z)-3-(furan-2-ylmethylidene)-2-oxoindol-1-yl]methyl]triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 127045885 |
| Molecular Formula | C30H30N4O11 |
| Molecular Weight | 622.59 g/mol |
| Exact Mass | 622.19 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[(3Z)-3-(furan-2-ylmethylidene)-2-oxoindol-1-yl]methyl]triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(CN3C(=O)/C(=C\c4ccco4)c4ccccc43)nn2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H30N4O11/c1-16(35)41-15-25-26(42-17(2)36)27(43-18(3)37)28(44-19(4)38)30(45-25)34-14-20(31-32-34)13-33-24-10-6-5-9-22(24)23(29(33)39)12-21-8-7-11-40-21/h5-12,14,25-28,30H,13,15H2,1-4H3/b23-12-/t25-,26-,27+,28-,30-/m1/s1 |
| InChIKey | WXPSEUCNLMHQMV-XGAVJLGYSA-N |
| XLogP | 2.21 |
| TPSA | 178.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.59 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|